About dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate
dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate (PubChem CID 134944149) has the molecular formula C16H18O5
and a molecular weight of 290.32 g/mol. Its IUPAC name is dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
| PubChem CID | 134944149 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OC)(C(=O)OC)CC12C=CC(=O)C=C2 |
| InChI | InChI=1S/C16H18O5/c1-4-11-9-16(13(18)20-2,14(19)21-3)10-15(11)7-5-12(17)6-8-15/h4-8,11H,1,9-10H2,2-3H3 |
| InChIKey | BSMMWRBIOKPBNN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate?
The IUPAC name of dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate (CID 134944149) is dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate.
What is the SMILES notation for dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate?
The canonical SMILES for dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate is C=CC1CC(C(=O)OC)(C(=O)OC)CC12C=CC(=O)C=C2.
What is the InChIKey of dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate?
The InChIKey is BSMMWRBIOKPBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O5/c1-4-11-9-16(13(18)20-2,14(19)21-3)10-15(11)7-5-12(17)6-8-15/h4-8,11H,1,9-10H2,2-3H3.
What are the key properties of dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate?
dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate has a molecular weight of 290.32 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate is sourced from PubChem (CID 134944149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).