C16H19NO2 — CID 13494418
6,7a-dimethyl-3-methylidene-5-phenyl-3a,4,5,7-tetrahydrofuro[2,3-c]pyridin-2-one (PubChem CID 13494418) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 6,7a-dimethyl-3-methylidene-5-phenyl-3a,4,5,7-tetrahydrofuro[2,3-c]pyridin-2-one.
| Compound Name | 6,7a-dimethyl-3-methylidene-5-phenyl-3a,4,5,7-tetrahydrofuro[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 13494418 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 6,7a-dimethyl-3-methylidene-5-phenyl-3a,4,5,7-tetrahydrofuro[2,3-c]pyridin-2-one |
| SMILES | C=C1C(=O)OC2(C)CN(C)C(c3ccccc3)CC12 |
| InChI | InChI=1S/C16H19NO2/c1-11-13-9-14(12-7-5-4-6-8-12)17(3)10-16(13,2)19-15(11)18/h4-8,13-14H,1,9-10H2,2-3H3 |
| InChIKey | KWAFPAXUOFTRRO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|