C17H30O3Si — CID 134944202
trans-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,2-dimethyl-6-oxocyclohexane-1-carbaldehyde (PubChem CID 134944202) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is trans-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,2-dimethyl-6-oxocyclohexane-1-carbaldehyde.
| Compound Name | trans-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,2-dimethyl-6-oxocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 134944202 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | trans-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1,2-dimethyl-6-oxocyclohexane-1-carbaldehyde |
| SMILES | C=C[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)C1(C)C=O |
| InChI | InChI=1S/C17H30O3Si/c1-9-16(5)14(20-21(7,8)15(2,3)4)11-10-13(19)17(16,6)12-18/h9,12,14H,1,10-11H2,2-8H3/t14-,16+,17?/m0/s1 |
| InChIKey | SGJSOLRIQYDKGS-NOYLFRNESA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|