C23H25NO4 — CID 134944232
[6-(1,3-dioxoisoindol-2-yl)-1-(4-methylphenyl)hexyl] acetate (PubChem CID 134944232) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [6-(1,3-dioxoisoindol-2-yl)-1-(4-methylphenyl)hexyl] acetate.
| Compound Name | [6-(1,3-dioxoisoindol-2-yl)-1-(4-methylphenyl)hexyl] acetate |
|---|---|
| PubChem CID | 134944232 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [6-(1,3-dioxoisoindol-2-yl)-1-(4-methylphenyl)hexyl] acetate |
| SMILES | CC(=O)OC(CCCCCN1C(=O)c2ccccc2C1=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-16-11-13-18(14-12-16)21(28-17(2)25)10-4-3-7-15-24-22(26)19-8-5-6-9-20(19)23(24)27/h5-6,8-9,11-14,21H,3-4,7,10,15H2,1-2H3 |
| InChIKey | ZWQWWEYUYFJWSJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|