C15H22O2 — CID 134944275
(2R)-10-hydroxy-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-en-11-one (PubChem CID 134944275) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2R)-10-hydroxy-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-en-11-one.
| Compound Name | (2R)-10-hydroxy-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-en-11-one |
|---|---|
| PubChem CID | 134944275 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2R)-10-hydroxy-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undec-8-en-11-one |
| SMILES | CC1=CC(O)C23C(=O)C1C(C)(C)C2CCC3C |
| InChI | InChI=1S/C15H22O2/c1-8-7-11(16)15-9(2)5-6-10(15)14(3,4)12(8)13(15)17/h7,9-12,16H,5-6H2,1-4H3 |
| InChIKey | BLTOXLGCOASVQT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|