About 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium
2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium (PubChem CID 134944287) has the molecular formula C14H13O+
and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium.
Molecular Properties
| Compound Name | 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium |
| PubChem CID | 134944287 |
| Molecular Formula | C14H13O+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium |
| SMILES | C1=C2C=C(c3ccccc3)[O+]=C2CCC1 |
| InChI | InChI=1S/C14H13O/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-3,6-8,10H,4-5,9H2/q+1 |
| InChIKey | IYCUOQZFWIHKQZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium?
The IUPAC name of 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium (CID 134944287) is 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium.
What is the SMILES notation for 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium?
The canonical SMILES for 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium is C1=C2C=C(c3ccccc3)[O+]=C2CCC1.
What is the InChIKey of 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium?
The InChIKey is IYCUOQZFWIHKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13O/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-3,6-8,10H,4-5,9H2/q+1.
What are the key properties of 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium?
2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium has a molecular weight of 197.26 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6,7-dihydro-5H-1-benzofuran-1-ium is sourced from PubChem (CID 134944287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).