C18H21NO4S — CID 134944324
methyl 3-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate (PubChem CID 134944324) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl 3-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate.
| Compound Name | methyl 3-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 134944324 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | methyl 3-[[(2,4,6-trimethylphenyl)sulfonylamino]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CNS(=O)(=O)c2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C18H21NO4S/c1-12-8-13(2)17(14(3)9-12)24(21,22)19-11-15-6-5-7-16(10-15)18(20)23-4/h5-10,19H,11H2,1-4H3 |
| InChIKey | XYXCKPLHLOWSJQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |