C30H54O2Si2 — CID 134944398
[(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-5-prop-1-ynyl-7-trimethylsilyloxy-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134944398) has the molecular formula C30H54O2Si2 and a molecular weight of 502.93 g/mol. Its IUPAC name is [(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-5-prop-1-ynyl-7-trimethylsilyloxy-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-5-prop-1-ynyl-7-trimethylsilyloxy-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134944398 |
| Molecular Formula | C30H54O2Si2 |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | [(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-5-prop-1-ynyl-7-trimethylsilyloxy-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC#C[C@@H]1C(C)=C(O[Si](C)(C)C)C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](C)[C@@H](CC=C(C)C)[C@]12C |
| InChI | InChI=1S/C30H54O2Si2/c1-15-16-25-23(5)27(31-33(10,11)12)20-26-28(32-34(13,14)29(6,7)8)19-22(4)24(30(25,26)9)18-17-21(2)3/h17,22,24-26,28H,18-20H2,1-14H3/t22-,24+,25+,26-,28-,30+/m0/s1 |
| InChIKey | BWWGOQKHWNOCOR-LGOHERATSA-N |
| XLogP | 9.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|