C11H20O2 — CID 134944590
(3R,4S,6S,7R)-3,7-dimethylnona-1,8-diene-4,6-diol (PubChem CID 134944590) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (3R,4S,6S,7R)-3,7-dimethylnona-1,8-diene-4,6-diol.
| Compound Name | (3R,4S,6S,7R)-3,7-dimethylnona-1,8-diene-4,6-diol |
|---|---|
| PubChem CID | 134944590 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (3R,4S,6S,7R)-3,7-dimethylnona-1,8-diene-4,6-diol |
| SMILES | C=C[C@@H](C)[C@@H](O)C[C@H](O)[C@H](C)C=C |
| InChI | InChI=1S/C11H20O2/c1-5-8(3)10(12)7-11(13)9(4)6-2/h5-6,8-13H,1-2,7H2,3-4H3/t8-,9-,10+,11+/m1/s1 |
| InChIKey | KZFYWSLVOJFJRJ-ZNSHCXBVSA-N |
| XLogP | 1.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|