C27H43NO5Si — CID 134944876
(E)-3-[(3aS,4R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzyl-N,N-diethylprop-2-enamide (PubChem CID 134944876) has the molecular formula C27H43NO5Si and a molecular weight of 489.73 g/mol. Its IUPAC name is (E)-3-[(3aS,4R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzyl-N,N-diethylprop-2-enamide.
| Compound Name | (E)-3-[(3aS,4R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzyl-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 134944876 |
| Molecular Formula | C27H43NO5Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (E)-3-[(3aS,4R,6R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-benzyl-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(=C/[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21)Cc1ccccc1 |
| InChI | InChI=1S/C27H43NO5Si/c1-10-28(11-2)24(29)20(17-19-15-13-12-14-16-19)18-21-22-23(32-27(6,7)31-22)25(30-21)33-34(8,9)26(3,4)5/h12-16,18,21-23,25H,10-11,17H2,1-9H3/b20-18+/t21-,22+,23+,25-/m1/s1 |
| InChIKey | MXSHOGRPRVZMKN-QXWRWLOFSA-N |
| XLogP | 5.29 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|