C34H48O6Si — CID 134944912
3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde (PubChem CID 134944912) has the molecular formula C34H48O6Si and a molecular weight of 580.84 g/mol. Its IUPAC name is 3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde.
| Compound Name | 3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde |
|---|---|
| PubChem CID | 134944912 |
| Molecular Formula | C34H48O6Si |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4-(methoxymethoxy)-6-(methoxymethoxymethyl)-1,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde |
| SMILES | COCOCC1CC2CC=C(CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2(C=O)C(OCOC)C1 |
| InChI | InChI=1S/C34H48O6Si/c1-33(2,3)41(30-14-8-6-9-15-30,31-16-10-7-11-17-31)40-20-12-13-28-18-19-29-21-27(23-38-25-36-4)22-32(39-26-37-5)34(28,29)24-35/h6-11,14-18,24,27,29,32H,12-13,19-23,25-26H2,1-5H3 |
| InChIKey | OUKWAINPOFACBA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|