C21H19NO5 — CID 134944939
methyl (3R,6'S)-1-methyl-2,4'-dioxo-6'-phenylspiro[indole-3,2'-oxane]-3'-carboxylate (PubChem CID 134944939) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl (3R,6'S)-1-methyl-2,4'-dioxo-6'-phenylspiro[indole-3,2'-oxane]-3'-carboxylate.
| Compound Name | methyl (3R,6'S)-1-methyl-2,4'-dioxo-6'-phenylspiro[indole-3,2'-oxane]-3'-carboxylate |
|---|---|
| PubChem CID | 134944939 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl (3R,6'S)-1-methyl-2,4'-dioxo-6'-phenylspiro[indole-3,2'-oxane]-3'-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@@H](c2ccccc2)O[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C21H19NO5/c1-22-15-11-7-6-10-14(15)21(20(22)25)18(19(24)26-2)16(23)12-17(27-21)13-8-4-3-5-9-13/h3-11,17-18H,12H2,1-2H3/t17-,18?,21-/m0/s1 |
| InChIKey | PZATXTGLVXVLRU-XBZLUXOVSA-N |
| XLogP | 2.38 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|