C22H37BO2 — CID 134944958
4,4,5,5-tetramethyl-2-[[2,4,6-tri(propan-2-yl)phenyl]methyl]-1,3,2-dioxaborolane (PubChem CID 134944958) has the molecular formula C22H37BO2 and a molecular weight of 344.35 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[[2,4,6-tri(propan-2-yl)phenyl]methyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[[2,4,6-tri(propan-2-yl)phenyl]methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134944958 |
| Molecular Formula | C22H37BO2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[[2,4,6-tri(propan-2-yl)phenyl]methyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)c1cc(C(C)C)c(CB2OC(C)(C)C(C)(C)O2)c(C(C)C)c1 |
| InChI | InChI=1S/C22H37BO2/c1-14(2)17-11-18(15(3)4)20(19(12-17)16(5)6)13-23-24-21(7,8)22(9,10)25-23/h11-12,14-16H,13H2,1-10H3 |
| InChIKey | PUYSHAUTZZNSMB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|