C19H17NO3 — CID 134945069
(3R,6'S)-1-methyl-6'-phenylspiro[indole-3,2'-oxane]-2,4'-dione (PubChem CID 134945069) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (3R,6'S)-1-methyl-6'-phenylspiro[indole-3,2'-oxane]-2,4'-dione.
| Compound Name | (3R,6'S)-1-methyl-6'-phenylspiro[indole-3,2'-oxane]-2,4'-dione |
|---|---|
| PubChem CID | 134945069 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3R,6'S)-1-methyl-6'-phenylspiro[indole-3,2'-oxane]-2,4'-dione |
| SMILES | CN1C(=O)[C@@]2(CC(=O)C[C@@H](c3ccccc3)O2)c2ccccc21 |
| InChI | InChI=1S/C19H17NO3/c1-20-16-10-6-5-9-15(16)19(18(20)22)12-14(21)11-17(23-19)13-7-3-2-4-8-13/h2-10,17H,11-12H2,1H3/t17-,19+/m0/s1 |
| InChIKey | SDCPKMGKYPQCCX-PKOBYXMFSA-N |
| XLogP | 2.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |