C26H37O4PSi2 — CID 134945098
(13-hydroxy-13-oxo-16-trimethylsilyl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaen-10-yl)-trimethylsilane (PubChem CID 134945098) has the molecular formula C26H37O4PSi2 and a molecular weight of 500.72 g/mol. Its IUPAC name is (13-hydroxy-13-oxo-16-trimethylsilyl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaen-10-yl)-trimethylsilane.
| Compound Name | (13-hydroxy-13-oxo-16-trimethylsilyl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaen-10-yl)-trimethylsilane |
|---|---|
| PubChem CID | 134945098 |
| Molecular Formula | C26H37O4PSi2 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (13-hydroxy-13-oxo-16-trimethylsilyl-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,8,10,15,17-hexaen-10-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc2c(c3c1OP(=O)(O)Oc1c([Si](C)(C)C)cc4c(c1-3)CCCC4)CCCC2 |
| InChI | InChI=1S/C26H37O4PSi2/c1-32(2,3)21-15-17-11-7-9-13-19(17)23-24-20-14-10-8-12-18(20)16-22(33(4,5)6)26(24)30-31(27,28)29-25(21)23/h15-16H,7-14H2,1-6H3,(H,27,28) |
| InChIKey | KETRODKUWBQPBF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|