C26H50O4Si2 — CID 134945192
(1aS,2aS,4S,6aS,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6a,7a-trimethyl-1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxiren-7-one (PubChem CID 134945192) has the molecular formula C26H50O4Si2 and a molecular weight of 482.85 g/mol. Its IUPAC name is (1aS,2aS,4S,6aS,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6a,7a-trimethyl-1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxiren-7-one.
| Compound Name | (1aS,2aS,4S,6aS,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6a,7a-trimethyl-1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxiren-7-one |
|---|---|
| PubChem CID | 134945192 |
| Molecular Formula | C26H50O4Si2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (1aS,2aS,4S,6aS,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6a,7a-trimethyl-1a,2,2a,4,5,6-hexahydronaphtho[2,3-b]oxiren-7-one |
| SMILES | CC1(CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)C(=O)[C@@]3(C)O[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H50O4Si2/c1-22(2,3)31(10,11)28-17-25(8)18-16-20-26(9,29-20)21(27)24(18,7)15-14-19(25)30-32(12,13)23(4,5)6/h18-20H,14-17H2,1-13H3/t18-,19+,20+,24+,25?,26+/m1/s1 |
| InChIKey | LDOFPORGRSRGNK-JHHQGWATSA-N |
| XLogP | 6.95 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|