C49H49ClCuN2 — CID 134945311
1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-2H-imidazol-2-ide;chlorocopper(1+) (PubChem CID 134945311) has the molecular formula C49H49ClCuN2 and a molecular weight of 764.94 g/mol. Its IUPAC name is 1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-2H-imidazol-2-ide;chlorocopper(1+).
| Compound Name | 1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-2H-imidazol-2-ide;chlorocopper(1+) |
|---|---|
| PubChem CID | 134945311 |
| Molecular Formula | C49H49ClCuN2 |
| Molecular Weight | 764.94 g/mol |
| Exact Mass | 763.29 |
| IUPAC Name | 1,3-bis[4-methyl-2,6-bis[(1R)-1-phenylethyl]phenyl]-2H-imidazol-2-ide;chlorocopper(1+) |
| SMILES | Cc1cc([C@H](C)c2ccccc2)c(N2C=CN(c3c([C@H](C)c4ccccc4)cc(C)cc3[C@H](C)c3ccccc3)[CH-]2)c([C@H](C)c2ccccc2)c1.Cl[Cu+] |
| InChI | InChI=1S/C49H49N2.ClH.Cu/c1-34-29-44(36(3)40-19-11-7-12-20-40)48(45(30-34)37(4)41-21-13-8-14-22-41)50-27-28-51(33-50)49-46(38(5)42-23-15-9-16-24-42)31-35(2)32-47(49)39(6)43-25-17-10-18-26-43;;/h7-33,36-39H,1-6H3;1H;/q-1;;+2/p-1/t36-,37-,38-,39-;;/m1../s1 |
| InChIKey | NLONZTDELHNQQJ-ZZWSONOOSA-M |
| XLogP | 13.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.94 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|