C27H21N6+3 — CID 134945449
28,30,32-triaza-29,31,33-triazoniaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene (PubChem CID 134945449) has the molecular formula C27H21N6+3 and a molecular weight of 429.51 g/mol. Its IUPAC name is 28,30,32-triaza-29,31,33-triazoniaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene.
| Compound Name | 28,30,32-triaza-29,31,33-triazoniaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene |
|---|---|
| PubChem CID | 134945449 |
| Molecular Formula | C27H21N6+3 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 28,30,32-triaza-29,31,33-triazoniaheptacyclo[22.3.1.12,5.16,10.111,14.115,19.120,23]tritriaconta-1,3,5(33),6,8,10,12,14(31),15,17,19,21,23(29),24,26-pentadecaene |
| SMILES | C1=C/C2=C3/C=CC(=[NH+]3)C3=CC=C/C(=C4/C=CC(=[NH+]4)C4=CC=C/C(=C5/C=CC(=[NH+]5)C(=C1)N2)N4)N3 |
| InChI | InChI=1S/C27H18N6/c1-4-16-22-10-12-24(31-22)18-6-2-8-20(29-18)26-14-15-27(33-26)21-9-3-7-19(30-21)25-13-11-23(32-25)17(5-1)28-16/h1-15,28-30H/p+3/b22-16-,23-17+,24-18+,25-19+,26-20+,27-21- |
| InChIKey | SOYWUBHEHCSDJJ-HFTPBXIKSA-Q |
| XLogP | -1.96 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|