C22H29NOSi — CID 134945483
(4R,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-5-propan-2-ylpyrrolidin-2-one (PubChem CID 134945483) has the molecular formula C22H29NOSi and a molecular weight of 351.57 g/mol. Its IUPAC name is (4R,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-5-propan-2-ylpyrrolidin-2-one.
| Compound Name | (4R,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-5-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 134945483 |
| Molecular Formula | C22H29NOSi |
| Molecular Weight | 351.57 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (4R,5R)-1-benzyl-4-[dimethyl(phenyl)silyl]-5-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)[C@@H]1[C@H]([Si](C)(C)c2ccccc2)CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H29NOSi/c1-17(2)22-20(25(3,4)19-13-9-6-10-14-19)15-21(24)23(22)16-18-11-7-5-8-12-18/h5-14,17,20,22H,15-16H2,1-4H3/t20-,22-/m1/s1 |
| InChIKey | OPLHVRMPAIOAIS-IFMALSPDSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|