About CID 134945585
CID 134945585 (PubChem CID 134945585) has the molecular formula H9NO9Si3
and a molecular weight of 251.33 g/mol.
Molecular Properties
| Compound Name | CID 134945585 |
| PubChem CID | 134945585 |
| Molecular Formula | H9NO9Si3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | — |
| SMILES | O[Si](O)(O)N[Si](O)(O)O[Si](O)(O)O |
| InChI | InChI=1S/H9NO9Si3/c2-11(3,4)1-12(5,6)10-13(7,8)9/h1-9H |
| InChIKey | YXYXERJTIGQRNN-UHFFFAOYSA-N |
| XLogP | -6.16 |
| TPSA | 183.10 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -6.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134945585 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134945585?
The IUPAC name of CID 134945585 (CID 134945585) is not available.
What is the SMILES notation for CID 134945585?
The canonical SMILES for CID 134945585 is O[Si](O)(O)N[Si](O)(O)O[Si](O)(O)O.
What is the InChIKey of CID 134945585?
The InChIKey is YXYXERJTIGQRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/H9NO9Si3/c2-11(3,4)1-12(5,6)10-13(7,8)9/h1-9H.
What are the key properties of CID 134945585?
CID 134945585 has a molecular weight of 251.33 g/mol, XLogP of -6.16, 4 rotatable bonds, 9 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134945585 is sourced from PubChem (CID 134945585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).