C28H32NOP — CID 134945619
[(5S)-9-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]spiro[4.4]nona-3,8-dien-4-yl]-diphenylphosphane (PubChem CID 134945619) has the molecular formula C28H32NOP and a molecular weight of 429.54 g/mol. Its IUPAC name is [(5S)-9-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]spiro[4.4]nona-3,8-dien-4-yl]-diphenylphosphane.
| Compound Name | [(5S)-9-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]spiro[4.4]nona-3,8-dien-4-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 134945619 |
| Molecular Formula | C28H32NOP |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [(5S)-9-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]spiro[4.4]nona-3,8-dien-4-yl]-diphenylphosphane |
| SMILES | CC(C)(C)[C@@H]1COC(C2=CCC[C@]23CCC=C3P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C28H32NOP/c1-27(2,3)24-20-30-26(29-24)23-16-10-18-28(23)19-11-17-25(28)31(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-9,12-17,24H,10-11,18-20H2,1-3H3/t24-,28-/m0/s1 |
| InChIKey | NXWKTPRTANNESU-CUBQBAPOSA-N |
| XLogP | 6.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|