C24H38O8 — CID 134945629
(E,3R,4R,6R)-8-[(2S,3S,7R,8E,10R,11R)-10,11-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-8-en-2-yl]-3-hydroxy-4,6-dimethyl-5-oxonon-7-enoic acid (PubChem CID 134945629) has the molecular formula C24H38O8 and a molecular weight of 454.56 g/mol. Its IUPAC name is (E,3R,4R,6R)-8-[(2S,3S,7R,8E,10R,11R)-10,11-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-8-en-2-yl]-3-hydroxy-4,6-dimethyl-5-oxonon-7-enoic acid.
| Compound Name | (E,3R,4R,6R)-8-[(2S,3S,7R,8E,10R,11R)-10,11-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-8-en-2-yl]-3-hydroxy-4,6-dimethyl-5-oxonon-7-enoic acid |
|---|---|
| PubChem CID | 134945629 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (E,3R,4R,6R)-8-[(2S,3S,7R,8E,10R,11R)-10,11-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-8-en-2-yl]-3-hydroxy-4,6-dimethyl-5-oxonon-7-enoic acid |
| SMILES | C/C(=C\[C@@H](C)C(=O)[C@H](C)[C@H](O)CC(=O)O)[C@H]1OC(=O)[C@H](O)[C@H](O)/C=C/[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C24H38O8/c1-13-7-6-8-14(2)23(32-24(31)22(30)18(25)10-9-13)16(4)11-15(3)21(29)17(5)19(26)12-20(27)28/h9-11,13-15,17-19,22-23,25-26,30H,6-8,12H2,1-5H3,(H,27,28)/b10-9+,16-11+/t13-,14+,15-,17-,18-,19-,22-,23+/m1/s1 |
| InChIKey | AHSIWIKONFOGDL-JQSIYGODSA-N |
| XLogP | 2.26 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|