C18H18F7NO3 — CID 134945711
(4S)-4-benzyl-5,5-dimethyl-3-[(2S)-3,4,4,4-tetrafluoro-2-methyl-3-(trifluoromethyl)butanoyl]-1,3-oxazolidin-2-one (PubChem CID 134945711) has the molecular formula C18H18F7NO3 and a molecular weight of 429.33 g/mol. Its IUPAC name is (4S)-4-benzyl-5,5-dimethyl-3-[(2S)-3,4,4,4-tetrafluoro-2-methyl-3-(trifluoromethyl)butanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-5,5-dimethyl-3-[(2S)-3,4,4,4-tetrafluoro-2-methyl-3-(trifluoromethyl)butanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134945711 |
| Molecular Formula | C18H18F7NO3 |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (4S)-4-benzyl-5,5-dimethyl-3-[(2S)-3,4,4,4-tetrafluoro-2-methyl-3-(trifluoromethyl)butanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC(C)(C)[C@@H]1Cc1ccccc1)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H18F7NO3/c1-10(16(19,17(20,21)22)18(23,24)25)13(27)26-12(15(2,3)29-14(26)28)9-11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | PADYERWCLTXSPM-JQWIXIFHSA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |