About 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide
1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 134945804) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide |
| PubChem CID | 134945804 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCC1CC(c2ccccc2)=NO1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N2O2/c23-19(20(11-12-20)16-9-5-2-6-10-16)21-14-17-13-18(22-24-17)15-7-3-1-4-8-15/h1-10,17H,11-14H2,(H,21,23) |
| InChIKey | AWGXENHYGRGOQP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide?
The IUPAC name of 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide (CID 134945804) is 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide.
What is the SMILES notation for 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide?
The canonical SMILES for 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide is O=C(NCC1CC(c2ccccc2)=NO1)C1(c2ccccc2)CC1.
What is the InChIKey of 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide?
The InChIKey is AWGXENHYGRGOQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2/c23-19(20(11-12-20)16-9-5-2-6-10-16)21-14-17-13-18(22-24-17)15-7-3-1-4-8-15/h1-10,17H,11-14H2,(H,21,23).
What are the key properties of 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide?
1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide has a molecular weight of 320.39 g/mol, XLogP of 3.03, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]cyclopropane-1-carboxamide is sourced from PubChem (CID 134945804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).