C21H22O3 — CID 134945876
cis-(2R,4S)-4-ethyl-2-phenyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione (PubChem CID 134945876) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is cis-(2R,4S)-4-ethyl-2-phenyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione.
| Compound Name | cis-(2R,4S)-4-ethyl-2-phenyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 134945876 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | cis-(2R,4S)-4-ethyl-2-phenyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione |
| SMILES | CC[C@H]1CC(=O)[C@](COCc2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H22O3/c1-2-17-13-19(22)21(20(17)23,18-11-7-4-8-12-18)15-24-14-16-9-5-3-6-10-16/h3-12,17H,2,13-15H2,1H3/t17-,21-/m0/s1 |
| InChIKey | OTSUIGMKCXFDHG-UWJYYQICSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|