C18H28O3 — CID 134946015
(2R,10R)-2-ethoxy-6,6a-dimethyl-9-methylidene-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-10-carbaldehyde (PubChem CID 134946015) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2R,10R)-2-ethoxy-6,6a-dimethyl-9-methylidene-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-10-carbaldehyde.
| Compound Name | (2R,10R)-2-ethoxy-6,6a-dimethyl-9-methylidene-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-10-carbaldehyde |
|---|---|
| PubChem CID | 134946015 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (2R,10R)-2-ethoxy-6,6a-dimethyl-9-methylidene-2,3a,4,5,6,7,8,10-octahydro-1H-benzo[d][1]benzofuran-10-carbaldehyde |
| SMILES | C=C1CCC2(C)C(C)CCC3O[C@@H](OCC)CC32[C@@H]1C=O |
| InChI | InChI=1S/C18H28O3/c1-5-20-16-10-18-14(11-19)12(2)8-9-17(18,4)13(3)6-7-15(18)21-16/h11,13-16H,2,5-10H2,1,3-4H3/t13?,14-,15?,16-,17?,18?/m1/s1 |
| InChIKey | JBQRAMMNGAOSTF-FBHFQMOLSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|