C18H21FO6 — CID 134946041
cis-triethyl (2S,3R)-2-fluoro-3-phenylcyclopropane-1,1,2-tricarboxylate (PubChem CID 134946041) has the molecular formula C18H21FO6 and a molecular weight of 352.36 g/mol. Its IUPAC name is cis-triethyl (2S,3R)-2-fluoro-3-phenylcyclopropane-1,1,2-tricarboxylate.
| Compound Name | cis-triethyl (2S,3R)-2-fluoro-3-phenylcyclopropane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 134946041 |
| Molecular Formula | C18H21FO6 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | cis-triethyl (2S,3R)-2-fluoro-3-phenylcyclopropane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H](c2ccccc2)[C@@]1(F)C(=O)OCC |
| InChI | InChI=1S/C18H21FO6/c1-4-23-14(20)17(15(21)24-5-2)13(12-10-8-7-9-11-12)18(17,19)16(22)25-6-3/h7-11,13H,4-6H2,1-3H3/t13-,18-/m1/s1 |
| InChIKey | DJOHTEZTNRJKIE-FZKQIMNGSA-N |
| XLogP | 2.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|