C29H31NO7 — CID 134946206
ethyl (1S,2S,3R,4R)-2-(1,3-benzodioxol-5-yl)-4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(piperidine-1-carbonyl)cyclobutane-1-carboxylate (PubChem CID 134946206) has the molecular formula C29H31NO7 and a molecular weight of 505.57 g/mol. Its IUPAC name is ethyl (1S,2S,3R,4R)-2-(1,3-benzodioxol-5-yl)-4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(piperidine-1-carbonyl)cyclobutane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3R,4R)-2-(1,3-benzodioxol-5-yl)-4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(piperidine-1-carbonyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 134946206 |
| Molecular Formula | C29H31NO7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | ethyl (1S,2S,3R,4R)-2-(1,3-benzodioxol-5-yl)-4-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(piperidine-1-carbonyl)cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](/C=C/c2ccc3c(c2)OCO3)[C@@H](C(=O)N2CCCCC2)[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H31NO7/c1-2-33-29(32)27-20(9-6-18-7-10-21-23(14-18)36-16-34-21)26(28(31)30-12-4-3-5-13-30)25(27)19-8-11-22-24(15-19)37-17-35-22/h6-11,14-15,20,25-27H,2-5,12-13,16-17H2,1H3/b9-6+/t20-,25+,26-,27+/m1/s1 |
| InChIKey | VZWRMXIJLGVSOM-IJQGIUNOSA-N |
| XLogP | 4.38 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |