C19H34O3Si — CID 134946270
[(2Z,4E,8Z)-1-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-6-yl] acetate (PubChem CID 134946270) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is [(2Z,4E,8Z)-1-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-6-yl] acetate.
| Compound Name | [(2Z,4E,8Z)-1-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-6-yl] acetate |
|---|---|
| PubChem CID | 134946270 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | [(2Z,4E,8Z)-1-[tert-butyl(dimethyl)silyl]oxyundeca-2,4,8-trien-6-yl] acetate |
| SMILES | CC/C=C\CC(/C=C/C=C\CO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C19H34O3Si/c1-8-9-11-14-18(22-17(2)20)15-12-10-13-16-21-23(6,7)19(3,4)5/h9-13,15,18H,8,14,16H2,1-7H3/b11-9-,13-10-,15-12+ |
| InChIKey | WNCWZQSQXXMQJT-WGOCYXPCSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|