C19H31BO6 — CID 134946340
diethyl 2-prop-2-enyl-2-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate (PubChem CID 134946340) has the molecular formula C19H31BO6 and a molecular weight of 366.26 g/mol. Its IUPAC name is diethyl 2-prop-2-enyl-2-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate.
| Compound Name | diethyl 2-prop-2-enyl-2-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 134946340 |
| Molecular Formula | C19H31BO6 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | diethyl 2-prop-2-enyl-2-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]propanedioate |
| SMILES | C=CCC(C/C=C\B1OC(C)(C)C(C)(C)O1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H31BO6/c1-8-12-19(15(21)23-9-2,16(22)24-10-3)13-11-14-20-25-17(4,5)18(6,7)26-20/h8,11,14H,1,9-10,12-13H2,2-7H3/b14-11- |
| InChIKey | QOXKPCVHAJVEJA-KAMYIIQDSA-N |
| XLogP | 3.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|