C17H26O4 — CID 134946542
(1S)-2',2'-dimethyl-1-propylspiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,5'-1,3-dioxane]-4',6'-dione (PubChem CID 134946542) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1S)-2',2'-dimethyl-1-propylspiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,5'-1,3-dioxane]-4',6'-dione.
| Compound Name | (1S)-2',2'-dimethyl-1-propylspiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,5'-1,3-dioxane]-4',6'-dione |
|---|---|
| PubChem CID | 134946542 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (1S)-2',2'-dimethyl-1-propylspiro[1,2,3a,4,5,6,7,7a-octahydroindene-3,5'-1,3-dioxane]-4',6'-dione |
| SMILES | CCC[C@H]1CC2(C(=O)OC(C)(C)OC2=O)C2CCCCC21 |
| InChI | InChI=1S/C17H26O4/c1-4-7-11-10-17(13-9-6-5-8-12(11)13)14(18)20-16(2,3)21-15(17)19/h11-13H,4-10H2,1-3H3/t11-,12?,13?/m0/s1 |
| InChIKey | YEAMVKAFJUHMAK-HIFPTAJRSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|