About cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one
cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one (PubChem CID 134946655) has the molecular formula C22H20O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one |
| PubChem CID | 134946655 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one |
| SMILES | O=C1C[C@H](c2ccccc2)C[C@H](c2ccc3ccccc3c2O)C1 |
| InChI | InChI=1S/C22H20O2/c23-19-13-17(15-6-2-1-3-7-15)12-18(14-19)21-11-10-16-8-4-5-9-20(16)22(21)24/h1-11,17-18,24H,12-14H2/t17-,18+/m1/s1 |
| InChIKey | YMKWKDSSURUGAJ-MSOLQXFVSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one?
The IUPAC name of cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one (CID 134946655) is cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one.
What is the SMILES notation for cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one?
The canonical SMILES for cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one is O=C1C[C@H](c2ccccc2)C[C@H](c2ccc3ccccc3c2O)C1.
What is the InChIKey of cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one?
The InChIKey is YMKWKDSSURUGAJ-MSOLQXFVSA-N. The full InChI is InChI=1S/C22H20O2/c23-19-13-17(15-6-2-1-3-7-15)12-18(14-19)21-11-10-16-8-4-5-9-20(16)22(21)24/h1-11,17-18,24H,12-14H2/t17-,18+/m1/s1.
What are the key properties of cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one?
cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one has a molecular weight of 316.40 g/mol, XLogP of 5.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3S,5R)-3-(1-hydroxynaphthalen-2-yl)-5-phenylcyclohexan-1-one is sourced from PubChem (CID 134946655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).