C18H20F3NO3 — CID 134946657
trifluoromethyl (2S,7aS)-2-(phenylmethoxymethyl)-2,3,5,6,7,7a-hexahydroindole-1-carboxylate (PubChem CID 134946657) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is trifluoromethyl (2S,7aS)-2-(phenylmethoxymethyl)-2,3,5,6,7,7a-hexahydroindole-1-carboxylate.
| Compound Name | trifluoromethyl (2S,7aS)-2-(phenylmethoxymethyl)-2,3,5,6,7,7a-hexahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 134946657 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | trifluoromethyl (2S,7aS)-2-(phenylmethoxymethyl)-2,3,5,6,7,7a-hexahydroindole-1-carboxylate |
| SMILES | O=C(OC(F)(F)F)N1[C@H](COCc2ccccc2)CC2=CCCC[C@@H]21 |
| InChI | InChI=1S/C18H20F3NO3/c19-18(20,21)25-17(23)22-15(10-14-8-4-5-9-16(14)22)12-24-11-13-6-2-1-3-7-13/h1-3,6-8,15-16H,4-5,9-12H2/t15-,16-/m0/s1 |
| InChIKey | JDZPOUQKTHXJRI-HOTGVXAUSA-N |
| XLogP | 4.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|