About 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione
5-amino-4,6-diphenyl-1H-pyrimidine-2-thione (PubChem CID 134946748) has the molecular formula C16H13N3S
and a molecular weight of 279.37 g/mol. Its IUPAC name is 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione |
| PubChem CID | 134946748 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione |
| SMILES | Nc1c(-c2ccccc2)nc(=S)[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C16H13N3S/c17-13-14(11-7-3-1-4-8-11)18-16(20)19-15(13)12-9-5-2-6-10-12/h1-10H,17H2,(H,18,19,20) |
| InChIKey | VCGZCRBRVAIORC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione?
The IUPAC name of 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione (CID 134946748) is 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione.
What is the SMILES notation for 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione?
The canonical SMILES for 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione is Nc1c(-c2ccccc2)nc(=S)[nH]c1-c1ccccc1.
What is the InChIKey of 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione?
The InChIKey is VCGZCRBRVAIORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3S/c17-13-14(11-7-3-1-4-8-11)18-16(20)19-15(13)12-9-5-2-6-10-12/h1-10H,17H2,(H,18,19,20).
What are the key properties of 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione?
5-amino-4,6-diphenyl-1H-pyrimidine-2-thione has a molecular weight of 279.37 g/mol, XLogP of 4.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4,6-diphenyl-1H-pyrimidine-2-thione is sourced from PubChem (CID 134946748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).