C22H36O4Si — CID 134946755
tert-butyl 2-[(3Z,5S)-2,2-bis[(Z)-but-2-enyl]-4,4-dimethyl-3-(1-oxopropan-2-ylidene)oxasilolan-5-yl]acetate (PubChem CID 134946755) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is tert-butyl 2-[(3Z,5S)-2,2-bis[(Z)-but-2-enyl]-4,4-dimethyl-3-(1-oxopropan-2-ylidene)oxasilolan-5-yl]acetate.
| Compound Name | tert-butyl 2-[(3Z,5S)-2,2-bis[(Z)-but-2-enyl]-4,4-dimethyl-3-(1-oxopropan-2-ylidene)oxasilolan-5-yl]acetate |
|---|---|
| PubChem CID | 134946755 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | tert-butyl 2-[(3Z,5S)-2,2-bis[(Z)-but-2-enyl]-4,4-dimethyl-3-(1-oxopropan-2-ylidene)oxasilolan-5-yl]acetate |
| SMILES | C/C=C\C[Si]1(C/C=C\C)O[C@@H](CC(=O)OC(C)(C)C)C(C)(C)/C1=C(\C)C=O |
| InChI | InChI=1S/C22H36O4Si/c1-9-11-13-27(14-12-10-2)20(17(3)16-23)22(7,8)18(26-27)15-19(24)25-21(4,5)6/h9-12,16,18H,13-15H2,1-8H3/b11-9-,12-10-,20-17-/t18-/m0/s1 |
| InChIKey | MXRKDUOHFZHYIZ-RATRPZAHSA-N |
| XLogP | 5.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|