C21H25NO2 — CID 134946823
N-benzyl-2-[(1R,2S,3S)-2-hydroxy-3-phenylcyclohexyl]acetamide (PubChem CID 134946823) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-benzyl-2-[(1R,2S,3S)-2-hydroxy-3-phenylcyclohexyl]acetamide.
| Compound Name | N-benzyl-2-[(1R,2S,3S)-2-hydroxy-3-phenylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 134946823 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-benzyl-2-[(1R,2S,3S)-2-hydroxy-3-phenylcyclohexyl]acetamide |
| SMILES | O=C(CC1CCC[C@@H](c2ccccc2)[C@H]1O)NCc1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c23-20(22-15-16-8-3-1-4-9-16)14-18-12-7-13-19(21(18)24)17-10-5-2-6-11-17/h1-6,8-11,18-19,21,24H,7,12-15H2,(H,22,23)/t18?,19-,21-/m0/s1 |
| InChIKey | INKHJLMBZPPWGJ-ZDZADGERSA-N |
| XLogP | 3.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |