C22H27F3O2 — CID 134946833
(8R,9S,13S,14S)-13-methyl-3-(4,4,4-trifluorobutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 134946833) has the molecular formula C22H27F3O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-(4,4,4-trifluorobutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-(4,4,4-trifluorobutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 134946833 |
| Molecular Formula | C22H27F3O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-(4,4,4-trifluorobutoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCC(F)(F)F)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C22H27F3O2/c1-21-11-9-17-16-6-4-15(27-12-2-10-22(23,24)25)13-14(16)3-5-18(17)19(21)7-8-20(21)26/h4,6,13,17-19H,2-3,5,7-12H2,1H3/t17-,18-,19+,21+/m1/s1 |
| InChIKey | PXNZRYAVRQLZGY-BNDYYXHWSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|