About N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide
N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide (PubChem CID 134947015) has the molecular formula C7H16NO5P
and a molecular weight of 225.18 g/mol. Its IUPAC name is N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide |
| PubChem CID | 134947015 |
| Molecular Formula | C7H16NO5P |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide |
| SMILES | COP(=O)(OC)[C@H](NC(C)=O)[C@H](C)O |
| InChI | InChI=1S/C7H16NO5P/c1-5(9)7(8-6(2)10)14(11,12-3)13-4/h5,7,9H,1-4H3,(H,8,10)/t5-,7-/m0/s1 |
| InChIKey | UZLZXSCHLAHHNE-FSPLSTOPSA-N |
| XLogP | 0.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide?
The IUPAC name of N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide (CID 134947015) is N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide.
What is the SMILES notation for N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide?
The canonical SMILES for N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide is COP(=O)(OC)[C@H](NC(C)=O)[C@H](C)O.
What is the InChIKey of N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide?
The InChIKey is UZLZXSCHLAHHNE-FSPLSTOPSA-N. The full InChI is InChI=1S/C7H16NO5P/c1-5(9)7(8-6(2)10)14(11,12-3)13-4/h5,7,9H,1-4H3,(H,8,10)/t5-,7-/m0/s1.
What are the key properties of N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide?
N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide has a molecular weight of 225.18 g/mol, XLogP of 0.32, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]acetamide is sourced from PubChem (CID 134947015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).