C24H28FNO2 — CID 134947037
9-(3-fluoro-4-methylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 134947037) has the molecular formula C24H28FNO2 and a molecular weight of 381.49 g/mol. Its IUPAC name is 9-(3-fluoro-4-methylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-(3-fluoro-4-methylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 134947037 |
| Molecular Formula | C24H28FNO2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 9-(3-fluoro-4-methylphenyl)-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc1F |
| InChI | InChI=1S/C24H28FNO2/c1-13-6-7-14(8-15(13)25)20-21-16(9-23(2,3)11-18(21)27)26-17-10-24(4,5)12-19(28)22(17)20/h6-8,20,26H,9-12H2,1-5H3 |
| InChIKey | HYDQEVBABWIOSV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |