C17H29NO5 — CID 134947169
ethyl (E,4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-4-propylhept-2-enoate (PubChem CID 134947169) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is ethyl (E,4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-4-propylhept-2-enoate.
| Compound Name | ethyl (E,4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-4-propylhept-2-enoate |
|---|---|
| PubChem CID | 134947169 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | ethyl (E,4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-4-propylhept-2-enoate |
| SMILES | CCC[C@@H](/C=C/C(=O)OCC)[C@H](NC(=O)OC(C)(C)C)C(C)=O |
| InChI | InChI=1S/C17H29NO5/c1-7-9-13(10-11-14(20)22-8-2)15(12(3)19)18-16(21)23-17(4,5)6/h10-11,13,15H,7-9H2,1-6H3,(H,18,21)/b11-10+/t13-,15+/m0/s1 |
| InChIKey | FGNZZGWAJDWTFM-VLMQMFMZSA-N |
| XLogP | 3.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|