C16H18O4 — CID 134947398
(6R)-6-hydroxyspiro[4-oxatricyclo[6.2.2.01,6]dodecane-2,3'-cyclohexa-1,4-diene]-5,9-dione (PubChem CID 134947398) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (6R)-6-hydroxyspiro[4-oxatricyclo[6.2.2.01,6]dodecane-2,3'-cyclohexa-1,4-diene]-5,9-dione.
| Compound Name | (6R)-6-hydroxyspiro[4-oxatricyclo[6.2.2.01,6]dodecane-2,3'-cyclohexa-1,4-diene]-5,9-dione |
|---|---|
| PubChem CID | 134947398 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (6R)-6-hydroxyspiro[4-oxatricyclo[6.2.2.01,6]dodecane-2,3'-cyclohexa-1,4-diene]-5,9-dione |
| SMILES | O=C1CC23CCC1C[C@]2(O)C(=O)OCC31C=CCC=C1 |
| InChI | InChI=1S/C16H18O4/c17-12-9-15-7-4-11(12)8-16(15,19)13(18)20-10-14(15)5-2-1-3-6-14/h2-3,5-6,11,19H,1,4,7-10H2/t11?,15?,16-/m0/s1 |
| InChIKey | VFVNVUACNNCLFN-LNTUIOFPSA-N |
| XLogP | 1.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|