C18H33N — CID 134947514
(2S,3R,6S)-1-cyclohexyl-2,3-diethyl-4,5,6-trimethyl-3,6-dihydro-2H-pyridine (PubChem CID 134947514) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is (2S,3R,6S)-1-cyclohexyl-2,3-diethyl-4,5,6-trimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | (2S,3R,6S)-1-cyclohexyl-2,3-diethyl-4,5,6-trimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 134947514 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (2S,3R,6S)-1-cyclohexyl-2,3-diethyl-4,5,6-trimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC[C@@H]1C(C)=C(C)[C@H](C)N(C2CCCCC2)[C@H]1CC |
| InChI | InChI=1S/C18H33N/c1-6-17-14(4)13(3)15(5)19(18(17)7-2)16-11-9-8-10-12-16/h15-18H,6-12H2,1-5H3/t15-,17+,18-/m0/s1 |
| InChIKey | QRFMELMCEMLFFY-JQHSSLGASA-N |
| XLogP | 5.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|