C36H25NO2 — CID 134947530
1-(2,3,6,7-tetraphenylfuro[2,3-f]indol-5-yl)ethanone (PubChem CID 134947530) has the molecular formula C36H25NO2 and a molecular weight of 503.60 g/mol. Its IUPAC name is 1-(2,3,6,7-tetraphenylfuro[2,3-f]indol-5-yl)ethanone.
| Compound Name | 1-(2,3,6,7-tetraphenylfuro[2,3-f]indol-5-yl)ethanone |
|---|---|
| PubChem CID | 134947530 |
| Molecular Formula | C36H25NO2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 1-(2,3,6,7-tetraphenylfuro[2,3-f]indol-5-yl)ethanone |
| SMILES | CC(=O)n1c(-c2ccccc2)c(-c2ccccc2)c2cc3oc(-c4ccccc4)c(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C36H25NO2/c1-24(38)37-31-22-30-32(39-36(28-20-12-5-13-21-28)34(30)26-16-8-3-9-17-26)23-29(31)33(25-14-6-2-7-15-25)35(37)27-18-10-4-11-19-27/h2-23H,1H3 |
| InChIKey | CEWBPNMMJLVNKF-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |