About [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate
[(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate (PubChem CID 134947646) has the molecular formula C23H25NO3
and a molecular weight of 363.46 g/mol. Its IUPAC name is [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate |
| PubChem CID | 134947646 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate |
| SMILES | CN1C(=O)[C@](C/C=C/OC(=O)C(C)(C)C)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H25NO3/c1-22(2,3)21(26)27-16-10-15-23(17-11-6-5-7-12-17)18-13-8-9-14-19(18)24(4)20(23)25/h5-14,16H,15H2,1-4H3/b16-10+/t23-/m1/s1 |
| InChIKey | ZKGYEPZRSQJZOT-PVBBERPISA-N |
| XLogP | 4.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate?
The IUPAC name of [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate (CID 134947646) is [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate is CN1C(=O)[C@](C/C=C/OC(=O)C(C)(C)C)(c2ccccc2)c2ccccc21.
What is the InChIKey of [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate?
The InChIKey is ZKGYEPZRSQJZOT-PVBBERPISA-N. The full InChI is InChI=1S/C23H25NO3/c1-22(2,3)21(26)27-16-10-15-23(17-11-6-5-7-12-17)18-13-8-9-14-19(18)24(4)20(23)25/h5-14,16H,15H2,1-4H3/b16-10+/t23-/m1/s1.
What are the key properties of [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate?
[(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate has a molecular weight of 363.46 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-[(3R)-1-methyl-2-oxo-3-phenylindol-3-yl]prop-1-enyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 134947646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).