C17H26O5Si — CID 134947679
4-[[(3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl]oxy]-6-methylpyran-2-one (PubChem CID 134947679) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is 4-[[(3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl]oxy]-6-methylpyran-2-one.
| Compound Name | 4-[[(3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl]oxy]-6-methylpyran-2-one |
|---|---|
| PubChem CID | 134947679 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-[[(3R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,6-dihydro-2H-pyran-3-yl]oxy]-6-methylpyran-2-one |
| SMILES | Cc1cc(O[C@@H]2C=C[C@@H](O[Si](C)(C)C(C)(C)C)OC2)cc(=O)o1 |
| InChI | InChI=1S/C17H26O5Si/c1-12-9-14(10-15(18)20-12)21-13-7-8-16(19-11-13)22-23(5,6)17(2,3)4/h7-10,13,16H,11H2,1-6H3/t13-,16-/m1/s1 |
| InChIKey | KMKFSYOFRUZNGV-CZUORRHYSA-N |
| XLogP | 3.63 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|