C25H31NO4 — CID 134947729
diethyl (2S,3aS)-1-(4-methylphenyl)-2-propan-2-yl-2,3a-dihydrocyclohepta[b]pyrrole-3,3-dicarboxylate (PubChem CID 134947729) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is diethyl (2S,3aS)-1-(4-methylphenyl)-2-propan-2-yl-2,3a-dihydrocyclohepta[b]pyrrole-3,3-dicarboxylate.
| Compound Name | diethyl (2S,3aS)-1-(4-methylphenyl)-2-propan-2-yl-2,3a-dihydrocyclohepta[b]pyrrole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 134947729 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | diethyl (2S,3aS)-1-(4-methylphenyl)-2-propan-2-yl-2,3a-dihydrocyclohepta[b]pyrrole-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H]2C=CC=CC=C2N(c2ccc(C)cc2)[C@H]1C(C)C |
| InChI | InChI=1S/C25H31NO4/c1-6-29-23(27)25(24(28)30-7-2)20-11-9-8-10-12-21(20)26(22(25)17(3)4)19-15-13-18(5)14-16-19/h8-17,20,22H,6-7H2,1-5H3/t20-,22+/m1/s1 |
| InChIKey | PWNAKJVFEQCUQK-IRLDBZIGSA-N |
| XLogP | 4.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|