About (E)-2,3-di(thiophen-3-yl)prop-2-enal
(E)-2,3-di(thiophen-3-yl)prop-2-enal (PubChem CID 134947754) has the molecular formula C11H8OS2
and a molecular weight of 220.32 g/mol. Its IUPAC name is (E)-2,3-di(thiophen-3-yl)prop-2-enal.
Molecular Properties
| Compound Name | (E)-2,3-di(thiophen-3-yl)prop-2-enal |
| PubChem CID | 134947754 |
| Molecular Formula | C11H8OS2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | (E)-2,3-di(thiophen-3-yl)prop-2-enal |
| SMILES | O=C/C(=C/c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C11H8OS2/c12-6-11(10-2-4-14-8-10)5-9-1-3-13-7-9/h1-8H/b11-5- |
| InChIKey | VWXZEVGLDLPRMC-WZUFQYTHSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-di(thiophen-3-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-di(thiophen-3-yl)prop-2-enal?
The IUPAC name of (E)-2,3-di(thiophen-3-yl)prop-2-enal (CID 134947754) is (E)-2,3-di(thiophen-3-yl)prop-2-enal.
What is the SMILES notation for (E)-2,3-di(thiophen-3-yl)prop-2-enal?
The canonical SMILES for (E)-2,3-di(thiophen-3-yl)prop-2-enal is O=C/C(=C/c1ccsc1)c1ccsc1.
What is the InChIKey of (E)-2,3-di(thiophen-3-yl)prop-2-enal?
The InChIKey is VWXZEVGLDLPRMC-WZUFQYTHSA-N. The full InChI is InChI=1S/C11H8OS2/c12-6-11(10-2-4-14-8-10)5-9-1-3-13-7-9/h1-8H/b11-5-.
What are the key properties of (E)-2,3-di(thiophen-3-yl)prop-2-enal?
(E)-2,3-di(thiophen-3-yl)prop-2-enal has a molecular weight of 220.32 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-di(thiophen-3-yl)prop-2-enal is sourced from PubChem (CID 134947754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).