C16H24O3 — CID 134947815
methyl (1S)-2-hydroxy-1-methyl-2-[(2S,3Z,5E)-2-methylhepta-3,5-dienyl]cyclopent-3-ene-1-carboxylate (PubChem CID 134947815) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl (1S)-2-hydroxy-1-methyl-2-[(2S,3Z,5E)-2-methylhepta-3,5-dienyl]cyclopent-3-ene-1-carboxylate.
| Compound Name | methyl (1S)-2-hydroxy-1-methyl-2-[(2S,3Z,5E)-2-methylhepta-3,5-dienyl]cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134947815 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl (1S)-2-hydroxy-1-methyl-2-[(2S,3Z,5E)-2-methylhepta-3,5-dienyl]cyclopent-3-ene-1-carboxylate |
| SMILES | C/C=C/C=C\[C@@H](C)CC1(O)C=CC[C@]1(C)C(=O)OC |
| InChI | InChI=1S/C16H24O3/c1-5-6-7-9-13(2)12-16(18)11-8-10-15(16,3)14(17)19-4/h5-9,11,13,18H,10,12H2,1-4H3/b6-5+,9-7-/t13-,15-,16?/m1/s1 |
| InChIKey | PCTWPBCGILVUCZ-GALORYFASA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|