C22H20ClNO8 — CID 134947834
dimethyl (1R,3S,7S)-3-(4-chlorophenyl)-4'-methoxy-4,5'-dioxospiro[2,3,3a,7a-tetrahydro-1H-isoindole-7,2'-furan]-1,3'-dicarboxylate (PubChem CID 134947834) has the molecular formula C22H20ClNO8 and a molecular weight of 461.85 g/mol. Its IUPAC name is dimethyl (1R,3S,7S)-3-(4-chlorophenyl)-4'-methoxy-4,5'-dioxospiro[2,3,3a,7a-tetrahydro-1H-isoindole-7,2'-furan]-1,3'-dicarboxylate.
| Compound Name | dimethyl (1R,3S,7S)-3-(4-chlorophenyl)-4'-methoxy-4,5'-dioxospiro[2,3,3a,7a-tetrahydro-1H-isoindole-7,2'-furan]-1,3'-dicarboxylate |
|---|---|
| PubChem CID | 134947834 |
| Molecular Formula | C22H20ClNO8 |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | dimethyl (1R,3S,7S)-3-(4-chlorophenyl)-4'-methoxy-4,5'-dioxospiro[2,3,3a,7a-tetrahydro-1H-isoindole-7,2'-furan]-1,3'-dicarboxylate |
| SMILES | COC(=O)C1=C(OC)C(=O)O[C@]12C=CC(=O)C1C2C(C(=O)OC)N[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClNO8/c1-29-18-15(19(26)30-2)22(32-21(18)28)9-8-12(25)13-14(22)17(20(27)31-3)24-16(13)10-4-6-11(23)7-5-10/h4-9,13-14,16-17,24H,1-3H3/t13?,14?,16-,17?,22+/m1/s1 |
| InChIKey | KZJCYIIQYCMJNB-DIVBKUIQSA-N |
| XLogP | 1.27 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|