C27H39NO4Si — CID 134947980
(2R,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethyl-1-morpholin-4-ylpentan-1-one (PubChem CID 134947980) has the molecular formula C27H39NO4Si and a molecular weight of 469.70 g/mol. Its IUPAC name is (2R,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethyl-1-morpholin-4-ylpentan-1-one.
| Compound Name | (2R,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethyl-1-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 134947980 |
| Molecular Formula | C27H39NO4Si |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (2R,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethyl-1-morpholin-4-ylpentan-1-one |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)[C@@H](C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H39NO4Si/c1-21(25(29)22(2)26(30)28-16-18-31-19-17-28)20-32-33(27(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,21-22,25,29H,16-20H2,1-5H3/t21-,22-,25+/m1/s1 |
| InChIKey | FUHSYHLIFDLULP-RQTOMXEWSA-N |
| XLogP | 3.05 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|